C17H26F2O6S2 — CID 134460934
3,5-diethyl-4,4-difluoro-5-phenoxysulfonylheptane-3-sulfonic acid (PubChem CID 134460934) has the molecular formula C17H26F2O6S2 and a molecular weight of 428.52 g/mol. Its IUPAC name is 3,5-diethyl-4,4-difluoro-5-phenoxysulfonylheptane-3-sulfonic acid.
| Compound Name | 3,5-diethyl-4,4-difluoro-5-phenoxysulfonylheptane-3-sulfonic acid |
|---|---|
| PubChem CID | 134460934 |
| Molecular Formula | C17H26F2O6S2 |
| Molecular Weight | 428.52 g/mol |
| Exact Mass | 428.11 |
| IUPAC Name | 3,5-diethyl-4,4-difluoro-5-phenoxysulfonylheptane-3-sulfonic acid |
| SMILES | CCC(CC)(C(F)(F)C(CC)(CC)S(=O)(=O)Oc1ccccc1)S(=O)(=O)O |
| InChI | InChI=1S/C17H26F2O6S2/c1-5-15(6-2,26(20,21)22)17(18,19)16(7-3,8-4)27(23,24)25-14-12-10-9-11-13-14/h9-13H,5-8H2,1-4H3,(H,20,21,22) |
| InChIKey | FJGYXHUIWMSLNZ-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 97.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.52 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|