C24H28FN5O3 — CID 134470035
N-(2-amino-6-methylphenyl)-4-(3-ethyl-4-methyl-5-oxo-1,2,4-triazol-1-yl)-5-fluoro-2-pent-4-en-2-yloxybenzamide (PubChem CID 134470035) has the molecular formula C24H28FN5O3 and a molecular weight of 453.52 g/mol. Its IUPAC name is N-(2-amino-6-methylphenyl)-4-(3-ethyl-4-methyl-5-oxo-1,2,4-triazol-1-yl)-5-fluoro-2-pent-4-en-2-yloxybenzamide.
| Compound Name | N-(2-amino-6-methylphenyl)-4-(3-ethyl-4-methyl-5-oxo-1,2,4-triazol-1-yl)-5-fluoro-2-pent-4-en-2-yloxybenzamide |
|---|---|
| PubChem CID | 134470035 |
| Molecular Formula | C24H28FN5O3 |
| Molecular Weight | 453.52 g/mol |
| Exact Mass | 453.22 |
| IUPAC Name | N-(2-amino-6-methylphenyl)-4-(3-ethyl-4-methyl-5-oxo-1,2,4-triazol-1-yl)-5-fluoro-2-pent-4-en-2-yloxybenzamide |
| SMILES | C=CCC(C)Oc1cc(-n2nc(CC)n(C)c2=O)c(F)cc1C(=O)Nc1c(C)cccc1N |
| InChI | InChI=1S/C24H28FN5O3/c1-6-9-15(4)33-20-13-19(30-24(32)29(5)21(7-2)28-30)17(25)12-16(20)23(31)27-22-14(3)10-8-11-18(22)26/h6,8,10-13,15H,1,7,9,26H2,2-5H3,(H,27,31) |
| InChIKey | YQCJHBSYWFIQQP-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 104.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.52 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|