C22H23ClF2N4O3 — CID 134469928
2-butoxy-N-(2-chloro-6-fluorophenyl)-4-(3-ethyl-4-methyl-5-oxo-1,2,4-triazol-1-yl)-5-fluorobenzamide (PubChem CID 134469928) has the molecular formula C22H23ClF2N4O3 and a molecular weight of 464.90 g/mol. Its IUPAC name is 2-butoxy-N-(2-chloro-6-fluorophenyl)-4-(3-ethyl-4-methyl-5-oxo-1,2,4-triazol-1-yl)-5-fluorobenzamide.
| Compound Name | 2-butoxy-N-(2-chloro-6-fluorophenyl)-4-(3-ethyl-4-methyl-5-oxo-1,2,4-triazol-1-yl)-5-fluorobenzamide |
|---|---|
| PubChem CID | 134469928 |
| Molecular Formula | C22H23ClF2N4O3 |
| Molecular Weight | 464.90 g/mol |
| Exact Mass | 464.14 |
| IUPAC Name | 2-butoxy-N-(2-chloro-6-fluorophenyl)-4-(3-ethyl-4-methyl-5-oxo-1,2,4-triazol-1-yl)-5-fluorobenzamide |
| SMILES | CCCCOc1cc(-n2nc(CC)n(C)c2=O)c(F)cc1C(=O)Nc1c(F)cccc1Cl |
| InChI | InChI=1S/C22H23ClF2N4O3/c1-4-6-10-32-18-12-17(29-22(31)28(3)19(5-2)27-29)16(25)11-13(18)21(30)26-20-14(23)8-7-9-15(20)24/h7-9,11-12H,4-6,10H2,1-3H3,(H,26,30) |
| InChIKey | HEPYKBLASBFAOQ-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 78.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.90 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|