C19H14F6N4O4 — CID 134470286
N-(2,6-difluorophenyl)-5-fluoro-4-[3-(hydroxymethyl)-4-methyl-5-oxo-1,2,4-triazol-1-yl]-2-(2,2,2-trifluoroethoxy)benzamide (PubChem CID 134470286) has the molecular formula C19H14F6N4O4 and a molecular weight of 476.33 g/mol. Its IUPAC name is N-(2,6-difluorophenyl)-5-fluoro-4-[3-(hydroxymethyl)-4-methyl-5-oxo-1,2,4-triazol-1-yl]-2-(2,2,2-trifluoroethoxy)benzamide.
| Compound Name | N-(2,6-difluorophenyl)-5-fluoro-4-[3-(hydroxymethyl)-4-methyl-5-oxo-1,2,4-triazol-1-yl]-2-(2,2,2-trifluoroethoxy)benzamide |
|---|---|
| PubChem CID | 134470286 |
| Molecular Formula | C19H14F6N4O4 |
| Molecular Weight | 476.33 g/mol |
| Exact Mass | 476.09 |
| IUPAC Name | N-(2,6-difluorophenyl)-5-fluoro-4-[3-(hydroxymethyl)-4-methyl-5-oxo-1,2,4-triazol-1-yl]-2-(2,2,2-trifluoroethoxy)benzamide |
| SMILES | Cn1c(CO)nn(-c2cc(OCC(F)(F)F)c(C(=O)Nc3c(F)cccc3F)cc2F)c1=O |
| InChI | InChI=1S/C19H14F6N4O4/c1-28-15(7-30)27-29(18(28)32)13-6-14(33-8-19(23,24)25)9(5-12(13)22)17(31)26-16-10(20)3-2-4-11(16)21/h2-6,30H,7-8H2,1H3,(H,26,31) |
| InChIKey | JBGOPSRGZYPYPG-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 98.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.33 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |