C21H18F6N4O4 — CID 134470391
N-(2,6-difluorophenyl)-5-fluoro-4-[3-(1-hydroxyethyl)-4-methyl-5-oxo-1,2,4-triazol-1-yl]-2-[(2S)-1,1,1-trifluoropropan-2-yl]oxybenzamide (PubChem CID 134470391) has the molecular formula C21H18F6N4O4 and a molecular weight of 504.39 g/mol. Its IUPAC name is N-(2,6-difluorophenyl)-5-fluoro-4-[3-(1-hydroxyethyl)-4-methyl-5-oxo-1,2,4-triazol-1-yl]-2-[(2S)-1,1,1-trifluoropropan-2-yl]oxybenzamide.
| Compound Name | N-(2,6-difluorophenyl)-5-fluoro-4-[3-(1-hydroxyethyl)-4-methyl-5-oxo-1,2,4-triazol-1-yl]-2-[(2S)-1,1,1-trifluoropropan-2-yl]oxybenzamide |
|---|---|
| PubChem CID | 134470391 |
| Molecular Formula | C21H18F6N4O4 |
| Molecular Weight | 504.39 g/mol |
| Exact Mass | 504.12 |
| IUPAC Name | N-(2,6-difluorophenyl)-5-fluoro-4-[3-(1-hydroxyethyl)-4-methyl-5-oxo-1,2,4-triazol-1-yl]-2-[(2S)-1,1,1-trifluoropropan-2-yl]oxybenzamide |
| SMILES | CC(O)c1nn(-c2cc(O[C@@H](C)C(F)(F)F)c(C(=O)Nc3c(F)cccc3F)cc2F)c(=O)n1C |
| InChI | InChI=1S/C21H18F6N4O4/c1-9(32)18-29-31(20(34)30(18)3)15-8-16(35-10(2)21(25,26)27)11(7-14(15)24)19(33)28-17-12(22)5-4-6-13(17)23/h4-10,32H,1-3H3,(H,28,33)/t9?,10-/m0/s1 |
| InChIKey | MUNGXDHIKDLDCR-AXDSSHIGSA-N |
| XLogP | 3.62 |
| TPSA | 98.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.39 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |