C21H16F6N4O4 — CID 134474142
N-(2,6-difluorophenyl)-5-fluoro-4-(3-oxo-6,8-dihydro-5H-[1,2,4]triazolo[3,4-c][1,4]oxazin-2-yl)-2-(1,1,1-trifluoropropan-2-yloxy)benzamide (PubChem CID 134474142) has the molecular formula C21H16F6N4O4 and a molecular weight of 502.37 g/mol. Its IUPAC name is N-(2,6-difluorophenyl)-5-fluoro-4-(3-oxo-6,8-dihydro-5H-[1,2,4]triazolo[3,4-c][1,4]oxazin-2-yl)-2-(1,1,1-trifluoropropan-2-yloxy)benzamide.
| Compound Name | N-(2,6-difluorophenyl)-5-fluoro-4-(3-oxo-6,8-dihydro-5H-[1,2,4]triazolo[3,4-c][1,4]oxazin-2-yl)-2-(1,1,1-trifluoropropan-2-yloxy)benzamide |
|---|---|
| PubChem CID | 134474142 |
| Molecular Formula | C21H16F6N4O4 |
| Molecular Weight | 502.37 g/mol |
| Exact Mass | 502.11 |
| IUPAC Name | N-(2,6-difluorophenyl)-5-fluoro-4-(3-oxo-6,8-dihydro-5H-[1,2,4]triazolo[3,4-c][1,4]oxazin-2-yl)-2-(1,1,1-trifluoropropan-2-yloxy)benzamide |
| SMILES | CC(Oc1cc(-n2nc3n(c2=O)CCOC3)c(F)cc1C(=O)Nc1c(F)cccc1F)C(F)(F)F |
| InChI | InChI=1S/C21H16F6N4O4/c1-10(21(25,26)27)35-16-8-15(31-20(33)30-5-6-34-9-17(30)29-31)14(24)7-11(16)19(32)28-18-12(22)3-2-4-13(18)23/h2-4,7-8,10H,5-6,9H2,1H3,(H,28,32) |
| InChIKey | VECNMUNMVFMBSH-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 87.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.37 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |