C21H19F6N5O4S — CID 175292906
N-(2,6-difluorophenyl)-4-[4-ethyl-3-(methylsulfonimidoyl)-5-oxo-1,2,4-triazol-1-yl]-5-fluoro-2-(1,1,1-trifluoropropan-2-yloxy)benzamide (PubChem CID 175292906) has the molecular formula C21H19F6N5O4S and a molecular weight of 551.47 g/mol. Its IUPAC name is N-(2,6-difluorophenyl)-4-[4-ethyl-3-(methylsulfonimidoyl)-5-oxo-1,2,4-triazol-1-yl]-5-fluoro-2-(1,1,1-trifluoropropan-2-yloxy)benzamide.
| Compound Name | N-(2,6-difluorophenyl)-4-[4-ethyl-3-(methylsulfonimidoyl)-5-oxo-1,2,4-triazol-1-yl]-5-fluoro-2-(1,1,1-trifluoropropan-2-yloxy)benzamide |
|---|---|
| PubChem CID | 175292906 |
| Molecular Formula | C21H19F6N5O4S |
| Molecular Weight | 551.47 g/mol |
| Exact Mass | 551.11 |
| IUPAC Name | N-(2,6-difluorophenyl)-4-[4-ethyl-3-(methylsulfonimidoyl)-5-oxo-1,2,4-triazol-1-yl]-5-fluoro-2-(1,1,1-trifluoropropan-2-yloxy)benzamide |
| SMILES | [H]N=S(C)(=O)c1nn(-c2cc(OC(C)C(F)(F)F)c(C(=O)Nc3c(F)cccc3F)cc2F)c(=O)n1CC |
| InChI | InChI=1S/C21H19F6N5O4S/c1-4-31-19(37(3,28)35)30-32(20(31)34)15-9-16(36-10(2)21(25,26)27)11(8-14(15)24)18(33)29-17-12(22)6-5-7-13(17)23/h5-10,28H,4H2,1-3H3,(H,29,33) |
| InChIKey | LOVCQMFYBZCNLK-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 119.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.47 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |