C21H18F6N4O3 — CID 134470397
4-(3,4-diethyl-5-oxo-1,2,4-triazol-1-yl)-N-(2,6-difluorophenyl)-5-fluoro-2-(2,2,2-trifluoroethoxy)benzamide (PubChem CID 134470397) has the molecular formula C21H18F6N4O3 and a molecular weight of 488.39 g/mol. Its IUPAC name is 4-(3,4-diethyl-5-oxo-1,2,4-triazol-1-yl)-N-(2,6-difluorophenyl)-5-fluoro-2-(2,2,2-trifluoroethoxy)benzamide.
| Compound Name | 4-(3,4-diethyl-5-oxo-1,2,4-triazol-1-yl)-N-(2,6-difluorophenyl)-5-fluoro-2-(2,2,2-trifluoroethoxy)benzamide |
|---|---|
| PubChem CID | 134470397 |
| Molecular Formula | C21H18F6N4O3 |
| Molecular Weight | 488.39 g/mol |
| Exact Mass | 488.13 |
| IUPAC Name | 4-(3,4-diethyl-5-oxo-1,2,4-triazol-1-yl)-N-(2,6-difluorophenyl)-5-fluoro-2-(2,2,2-trifluoroethoxy)benzamide |
| SMILES | CCc1nn(-c2cc(OCC(F)(F)F)c(C(=O)Nc3c(F)cccc3F)cc2F)c(=O)n1CC |
| InChI | InChI=1S/C21H18F6N4O3/c1-3-17-29-31(20(33)30(17)4-2)15-9-16(34-10-21(25,26)27)11(8-14(15)24)19(32)28-18-12(22)6-5-7-13(18)23/h5-9H,3-4,10H2,1-2H3,(H,28,32) |
| InChIKey | AJJXPFLCUMAZAR-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 78.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.39 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |