C19H14F6N4O3 — CID 134470197
N-(2,6-difluorophenyl)-4-(3,4-dimethyl-5-oxo-1,2,4-triazol-1-yl)-5-fluoro-2-(2,2,2-trifluoroethoxy)benzamide (PubChem CID 134470197) has the molecular formula C19H14F6N4O3 and a molecular weight of 460.33 g/mol. Its IUPAC name is N-(2,6-difluorophenyl)-4-(3,4-dimethyl-5-oxo-1,2,4-triazol-1-yl)-5-fluoro-2-(2,2,2-trifluoroethoxy)benzamide.
| Compound Name | N-(2,6-difluorophenyl)-4-(3,4-dimethyl-5-oxo-1,2,4-triazol-1-yl)-5-fluoro-2-(2,2,2-trifluoroethoxy)benzamide |
|---|---|
| PubChem CID | 134470197 |
| Molecular Formula | C19H14F6N4O3 |
| Molecular Weight | 460.33 g/mol |
| Exact Mass | 460.10 |
| IUPAC Name | N-(2,6-difluorophenyl)-4-(3,4-dimethyl-5-oxo-1,2,4-triazol-1-yl)-5-fluoro-2-(2,2,2-trifluoroethoxy)benzamide |
| SMILES | Cc1nn(-c2cc(OCC(F)(F)F)c(C(=O)Nc3c(F)cccc3F)cc2F)c(=O)n1C |
| InChI | InChI=1S/C19H14F6N4O3/c1-9-27-29(18(31)28(9)2)14-7-15(32-8-19(23,24)25)10(6-13(14)22)17(30)26-16-11(20)4-3-5-12(16)21/h3-7H,8H2,1-2H3,(H,26,30) |
| InChIKey | NLLVWUABSCDRCB-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 78.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.33 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |