C21H16F6N4O3 — CID 134473932
N-(2,6-difluorophenyl)-5-fluoro-4-(3-oxo-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-2-yl)-2-(2,2,2-trifluoroethoxy)benzamide (PubChem CID 134473932) has the molecular formula C21H16F6N4O3 and a molecular weight of 486.37 g/mol. Its IUPAC name is N-(2,6-difluorophenyl)-5-fluoro-4-(3-oxo-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-2-yl)-2-(2,2,2-trifluoroethoxy)benzamide.
| Compound Name | N-(2,6-difluorophenyl)-5-fluoro-4-(3-oxo-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-2-yl)-2-(2,2,2-trifluoroethoxy)benzamide |
|---|---|
| PubChem CID | 134473932 |
| Molecular Formula | C21H16F6N4O3 |
| Molecular Weight | 486.37 g/mol |
| Exact Mass | 486.11 |
| IUPAC Name | N-(2,6-difluorophenyl)-5-fluoro-4-(3-oxo-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-2-yl)-2-(2,2,2-trifluoroethoxy)benzamide |
| SMILES | O=C(Nc1c(F)cccc1F)c1cc(F)c(-n2nc3n(c2=O)CCCC3)cc1OCC(F)(F)F |
| InChI | InChI=1S/C21H16F6N4O3/c22-12-4-3-5-13(23)18(12)28-19(32)11-8-14(24)15(9-16(11)34-10-21(25,26)27)31-20(33)30-7-2-1-6-17(30)29-31/h3-5,8-9H,1-2,6-7,10H2,(H,28,32) |
| InChIKey | QETUXWVPINWBQA-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 78.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.37 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |