C22H18F6N4O3 — CID 134473929
N-(2,6-difluorophenyl)-5-fluoro-4-(3-oxo-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-2-yl)-2-[(2S)-1,1,1-trifluoropropan-2-yl]oxybenzamide (PubChem CID 134473929) has the molecular formula C22H18F6N4O3 and a molecular weight of 500.40 g/mol. Its IUPAC name is N-(2,6-difluorophenyl)-5-fluoro-4-(3-oxo-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-2-yl)-2-[(2S)-1,1,1-trifluoropropan-2-yl]oxybenzamide.
| Compound Name | N-(2,6-difluorophenyl)-5-fluoro-4-(3-oxo-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-2-yl)-2-[(2S)-1,1,1-trifluoropropan-2-yl]oxybenzamide |
|---|---|
| PubChem CID | 134473929 |
| Molecular Formula | C22H18F6N4O3 |
| Molecular Weight | 500.40 g/mol |
| Exact Mass | 500.13 |
| IUPAC Name | N-(2,6-difluorophenyl)-5-fluoro-4-(3-oxo-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-2-yl)-2-[(2S)-1,1,1-trifluoropropan-2-yl]oxybenzamide |
| SMILES | C[C@H](Oc1cc(-n2nc3n(c2=O)CCCC3)c(F)cc1C(=O)Nc1c(F)cccc1F)C(F)(F)F |
| InChI | InChI=1S/C22H18F6N4O3/c1-11(22(26,27)28)35-17-10-16(32-21(34)31-8-3-2-7-18(31)30-32)15(25)9-12(17)20(33)29-19-13(23)5-4-6-14(19)24/h4-6,9-11H,2-3,7-8H2,1H3,(H,29,33)/t11-/m0/s1 |
| InChIKey | XONSCWSPGKDGPM-NSHDSACASA-N |
| XLogP | 4.37 |
| TPSA | 78.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.40 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |