C16H16Cl2N6S — CID 134470629
3-N-[3,5-dichloro-4-[4-(dimethylaminosulfanyl)phenyl]phenyl]-1H-1,2,4-triazole-3,5-diamine (PubChem CID 134470629) has the molecular formula C16H16Cl2N6S and a molecular weight of 395.32 g/mol. Its IUPAC name is 3-N-[3,5-dichloro-4-[4-(dimethylaminosulfanyl)phenyl]phenyl]-1H-1,2,4-triazole-3,5-diamine.
| Compound Name | 3-N-[3,5-dichloro-4-[4-(dimethylaminosulfanyl)phenyl]phenyl]-1H-1,2,4-triazole-3,5-diamine |
|---|---|
| PubChem CID | 134470629 |
| Molecular Formula | C16H16Cl2N6S |
| Molecular Weight | 395.32 g/mol |
| Exact Mass | 394.05 |
| IUPAC Name | 3-N-[3,5-dichloro-4-[4-(dimethylaminosulfanyl)phenyl]phenyl]-1H-1,2,4-triazole-3,5-diamine |
| SMILES | CN(C)Sc1ccc(-c2c(Cl)cc(Nc3n[nH]c(N)n3)cc2Cl)cc1 |
| InChI | InChI=1S/C16H16Cl2N6S/c1-24(2)25-11-5-3-9(4-6-11)14-12(17)7-10(8-13(14)18)20-16-21-15(19)22-23-16/h3-8H,1-2H3,(H4,19,20,21,22,23) |
| InChIKey | SCFCCBXBUWWCRG-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 82.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.32 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|