C13H20N3OPS — CID 134471122
N-[2-[(1,3-dimethyl-1,3,2-diazaphospholidin-2-yl)sulfanyl]ethyl]benzamide (PubChem CID 134471122) has the molecular formula C13H20N3OPS and a molecular weight of 297.36 g/mol. Its IUPAC name is N-[2-[(1,3-dimethyl-1,3,2-diazaphospholidin-2-yl)sulfanyl]ethyl]benzamide.
| Compound Name | N-[2-[(1,3-dimethyl-1,3,2-diazaphospholidin-2-yl)sulfanyl]ethyl]benzamide |
|---|---|
| PubChem CID | 134471122 |
| Molecular Formula | C13H20N3OPS |
| Molecular Weight | 297.36 g/mol |
| Exact Mass | 297.11 |
| IUPAC Name | N-[2-[(1,3-dimethyl-1,3,2-diazaphospholidin-2-yl)sulfanyl]ethyl]benzamide |
| SMILES | CN1CCN(C)P1SCCNC(=O)c1ccccc1 |
| InChI | InChI=1S/C13H20N3OPS/c1-15-9-10-16(2)18(15)19-11-8-14-13(17)12-6-4-3-5-7-12/h3-7H,8-11H2,1-2H3,(H,14,17) |
| InChIKey | LYAOVOPYYRCKDN-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.36 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|