C14H23N3O2P+ — CID 25198708
N-[2-[(1,2,3-trimethyl-1,3,2-diazaphospholidin-2-ium-2-yl)oxy]ethyl]benzamide (PubChem CID 25198708) has the molecular formula C14H23N3O2P+ and a molecular weight of 296.33 g/mol. Its IUPAC name is N-[2-[(1,2,3-trimethyl-1,3,2-diazaphospholidin-2-ium-2-yl)oxy]ethyl]benzamide.
| Compound Name | N-[2-[(1,2,3-trimethyl-1,3,2-diazaphospholidin-2-ium-2-yl)oxy]ethyl]benzamide |
|---|---|
| PubChem CID | 25198708 |
| Molecular Formula | C14H23N3O2P+ |
| Molecular Weight | 296.33 g/mol |
| Exact Mass | 296.15 |
| IUPAC Name | N-[2-[(1,2,3-trimethyl-1,3,2-diazaphospholidin-2-ium-2-yl)oxy]ethyl]benzamide |
| SMILES | CN1CCN(C)[P+]1(C)OCCNC(=O)c1ccccc1 |
| InChI | InChI=1S/C14H22N3O2P/c1-16-10-11-17(2)20(16,3)19-12-9-15-14(18)13-7-5-4-6-8-13/h4-8H,9-12H2,1-3H3/p+1 |
| InChIKey | BIUZZMVLODTEQJ-UHFFFAOYSA-O |
| XLogP | 1.70 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.33 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|