C23H24N3O2P — CID 118949792
N-[2-[(1,3-diphenyl-1,3,2-diazaphospholidin-2-yl)oxy]ethyl]benzamide (PubChem CID 118949792) has the molecular formula C23H24N3O2P and a molecular weight of 405.44 g/mol. Its IUPAC name is N-[2-[(1,3-diphenyl-1,3,2-diazaphospholidin-2-yl)oxy]ethyl]benzamide.
| Compound Name | N-[2-[(1,3-diphenyl-1,3,2-diazaphospholidin-2-yl)oxy]ethyl]benzamide |
|---|---|
| PubChem CID | 118949792 |
| Molecular Formula | C23H24N3O2P |
| Molecular Weight | 405.44 g/mol |
| Exact Mass | 405.16 |
| IUPAC Name | N-[2-[(1,3-diphenyl-1,3,2-diazaphospholidin-2-yl)oxy]ethyl]benzamide |
| SMILES | O=C(NCCOP1N(c2ccccc2)CCN1c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C23H24N3O2P/c27-23(20-10-4-1-5-11-20)24-16-19-28-29-25(21-12-6-2-7-13-21)17-18-26(29)22-14-8-3-9-15-22/h1-15H,16-19H2,(H,24,27) |
| InChIKey | FKNASHSJHLICON-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.44 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|