C27H31ClF2N4O3 — CID 134473976
N-[4-[(2-chloro-6-fluorophenyl)carbamoyl]-5-(1-cyclohexylethoxy)-2-fluorophenyl]-2-iminopiperidine-1-carboxamide (PubChem CID 134473976) has the molecular formula C27H31ClF2N4O3 and a molecular weight of 533.02 g/mol. Its IUPAC name is N-[4-[(2-chloro-6-fluorophenyl)carbamoyl]-5-(1-cyclohexylethoxy)-2-fluorophenyl]-2-iminopiperidine-1-carboxamide.
| Compound Name | N-[4-[(2-chloro-6-fluorophenyl)carbamoyl]-5-(1-cyclohexylethoxy)-2-fluorophenyl]-2-iminopiperidine-1-carboxamide |
|---|---|
| PubChem CID | 134473976 |
| Molecular Formula | C27H31ClF2N4O3 |
| Molecular Weight | 533.02 g/mol |
| Exact Mass | 532.21 |
| IUPAC Name | N-[4-[(2-chloro-6-fluorophenyl)carbamoyl]-5-(1-cyclohexylethoxy)-2-fluorophenyl]-2-iminopiperidine-1-carboxamide |
| SMILES | [H]/N=C1\CCCCN1C(=O)Nc1cc(OC(C)C2CCCCC2)c(C(=O)Nc2c(F)cccc2Cl)cc1F |
| InChI | InChI=1S/C27H31ClF2N4O3/c1-16(17-8-3-2-4-9-17)37-23-15-22(32-27(36)34-13-6-5-12-24(34)31)21(30)14-18(23)26(35)33-25-19(28)10-7-11-20(25)29/h7,10-11,14-17,31H,2-6,8-9,12-13H2,1H3,(H,32,36)(H,33,35)/b31-24+ |
| InChIKey | VLDVEOUZUVJTNS-QFMPWRQOSA-N |
| XLogP | 7.21 |
| TPSA | 94.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.02 |
| LogP ≤ 5 | 7.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|