C19H26ClFN4O2S2 — CID 134477143
5-chloro-2-fluoro-4-[(1,2,2,6,6-pentamethylpiperidin-4-yl)amino]-N-(1,3-thiazol-2-yl)benzenesulfonamide (PubChem CID 134477143) has the molecular formula C19H26ClFN4O2S2 and a molecular weight of 461.03 g/mol. Its IUPAC name is 5-chloro-2-fluoro-4-[(1,2,2,6,6-pentamethylpiperidin-4-yl)amino]-N-(1,3-thiazol-2-yl)benzenesulfonamide.
| Compound Name | 5-chloro-2-fluoro-4-[(1,2,2,6,6-pentamethylpiperidin-4-yl)amino]-N-(1,3-thiazol-2-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 134477143 |
| Molecular Formula | C19H26ClFN4O2S2 |
| Molecular Weight | 461.03 g/mol |
| Exact Mass | 460.12 |
| IUPAC Name | 5-chloro-2-fluoro-4-[(1,2,2,6,6-pentamethylpiperidin-4-yl)amino]-N-(1,3-thiazol-2-yl)benzenesulfonamide |
| SMILES | CN1C(C)(C)CC(Nc2cc(F)c(S(=O)(=O)Nc3nccs3)cc2Cl)CC1(C)C |
| InChI | InChI=1S/C19H26ClFN4O2S2/c1-18(2)10-12(11-19(3,4)25(18)5)23-15-9-14(21)16(8-13(15)20)29(26,27)24-17-22-6-7-28-17/h6-9,12,23H,10-11H2,1-5H3,(H,22,24) |
| InChIKey | KOZQVDNHYNYMCA-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 74.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.03 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |