About 9H-carbazole-1,5-dicarbonitrile
9H-carbazole-1,5-dicarbonitrile (PubChem CID 134477332) has the molecular formula C14H7N3
and a molecular weight of 217.23 g/mol. Its IUPAC name is 9H-carbazole-1,5-dicarbonitrile.
Molecular Properties
| Compound Name | 9H-carbazole-1,5-dicarbonitrile |
| PubChem CID | 134477332 |
| Molecular Formula | C14H7N3 |
| Molecular Weight | 217.23 g/mol |
| Exact Mass | 217.06 |
| IUPAC Name | 9H-carbazole-1,5-dicarbonitrile |
| SMILES | N#Cc1cccc2c1[nH]c1cccc(C#N)c12 |
| InChI | InChI=1S/C14H7N3/c15-7-9-3-2-6-12-13(9)11-5-1-4-10(8-16)14(11)17-12/h1-6,17H |
| InChIKey | AKBDFXXJSYSYSH-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 63.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.23 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 9H-carbazole-1,5-dicarbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9H-carbazole-1,5-dicarbonitrile?
The IUPAC name of 9H-carbazole-1,5-dicarbonitrile (CID 134477332) is 9H-carbazole-1,5-dicarbonitrile.
What is the SMILES notation for 9H-carbazole-1,5-dicarbonitrile?
The canonical SMILES for 9H-carbazole-1,5-dicarbonitrile is N#Cc1cccc2c1[nH]c1cccc(C#N)c12.
What is the InChIKey of 9H-carbazole-1,5-dicarbonitrile?
The InChIKey is AKBDFXXJSYSYSH-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H7N3/c15-7-9-3-2-6-12-13(9)11-5-1-4-10(8-16)14(11)17-12/h1-6,17H.
What are the key properties of 9H-carbazole-1,5-dicarbonitrile?
9H-carbazole-1,5-dicarbonitrile has a molecular weight of 217.23 g/mol, XLogP of 3.06, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 9H-carbazole-1,5-dicarbonitrile is sourced from PubChem (CID 134477332), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).