C28H26N2O6S2 — CID 134479225
N-(5,6-dimethoxy-1,3-benzothiazol-2-yl)-2-(4-ethylsulfonylphenyl)-2-(4-ethynyl-2-methylphenoxy)acetamide (PubChem CID 134479225) has the molecular formula C28H26N2O6S2 and a molecular weight of 550.66 g/mol. Its IUPAC name is N-(5,6-dimethoxy-1,3-benzothiazol-2-yl)-2-(4-ethylsulfonylphenyl)-2-(4-ethynyl-2-methylphenoxy)acetamide.
| Compound Name | N-(5,6-dimethoxy-1,3-benzothiazol-2-yl)-2-(4-ethylsulfonylphenyl)-2-(4-ethynyl-2-methylphenoxy)acetamide |
|---|---|
| PubChem CID | 134479225 |
| Molecular Formula | C28H26N2O6S2 |
| Molecular Weight | 550.66 g/mol |
| Exact Mass | 550.12 |
| IUPAC Name | N-(5,6-dimethoxy-1,3-benzothiazol-2-yl)-2-(4-ethylsulfonylphenyl)-2-(4-ethynyl-2-methylphenoxy)acetamide |
| SMILES | C#Cc1ccc(OC(C(=O)Nc2nc3cc(OC)c(OC)cc3s2)c2ccc(S(=O)(=O)CC)cc2)c(C)c1 |
| InChI | InChI=1S/C28H26N2O6S2/c1-6-18-8-13-22(17(3)14-18)36-26(19-9-11-20(12-10-19)38(32,33)7-2)27(31)30-28-29-21-15-23(34-4)24(35-5)16-25(21)37-28/h1,8-16,26H,7H2,2-5H3,(H,29,30,31) |
| InChIKey | OSOPOMZWULPNPK-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 103.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.66 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|