C27H25N3O5S2 — CID 145181372
2-(4-cyanophenoxy)-N-(5,6-dimethoxy-1,3-benzothiazol-2-yl)-2-[4-(2-methoxyethylsulfanyl)phenyl]acetamide (PubChem CID 145181372) has the molecular formula C27H25N3O5S2 and a molecular weight of 535.65 g/mol. Its IUPAC name is 2-(4-cyanophenoxy)-N-(5,6-dimethoxy-1,3-benzothiazol-2-yl)-2-[4-(2-methoxyethylsulfanyl)phenyl]acetamide.
| Compound Name | 2-(4-cyanophenoxy)-N-(5,6-dimethoxy-1,3-benzothiazol-2-yl)-2-[4-(2-methoxyethylsulfanyl)phenyl]acetamide |
|---|---|
| PubChem CID | 145181372 |
| Molecular Formula | C27H25N3O5S2 |
| Molecular Weight | 535.65 g/mol |
| Exact Mass | 535.12 |
| IUPAC Name | 2-(4-cyanophenoxy)-N-(5,6-dimethoxy-1,3-benzothiazol-2-yl)-2-[4-(2-methoxyethylsulfanyl)phenyl]acetamide |
| SMILES | COCCSc1ccc(C(Oc2ccc(C#N)cc2)C(=O)Nc2nc3cc(OC)c(OC)cc3s2)cc1 |
| InChI | InChI=1S/C27H25N3O5S2/c1-32-12-13-36-20-10-6-18(7-11-20)25(35-19-8-4-17(16-28)5-9-19)26(31)30-27-29-21-14-22(33-2)23(34-3)15-24(21)37-27/h4-11,14-15,25H,12-13H2,1-3H3,(H,29,30,31) |
| InChIKey | LSNYTYTZLHWNFL-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 102.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.65 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|