C27H26N4O5S2 — CID 145181290
2-(4-cyanophenoxy)-N-(5,6-dimethoxy-1,3-benzothiazol-2-yl)-2-[4-(2-methoxyethylamino)sulfanylphenyl]acetamide (PubChem CID 145181290) has the molecular formula C27H26N4O5S2 and a molecular weight of 550.66 g/mol. Its IUPAC name is 2-(4-cyanophenoxy)-N-(5,6-dimethoxy-1,3-benzothiazol-2-yl)-2-[4-(2-methoxyethylamino)sulfanylphenyl]acetamide.
| Compound Name | 2-(4-cyanophenoxy)-N-(5,6-dimethoxy-1,3-benzothiazol-2-yl)-2-[4-(2-methoxyethylamino)sulfanylphenyl]acetamide |
|---|---|
| PubChem CID | 145181290 |
| Molecular Formula | C27H26N4O5S2 |
| Molecular Weight | 550.66 g/mol |
| Exact Mass | 550.13 |
| IUPAC Name | 2-(4-cyanophenoxy)-N-(5,6-dimethoxy-1,3-benzothiazol-2-yl)-2-[4-(2-methoxyethylamino)sulfanylphenyl]acetamide |
| SMILES | COCCNSc1ccc(C(Oc2ccc(C#N)cc2)C(=O)Nc2nc3cc(OC)c(OC)cc3s2)cc1 |
| InChI | InChI=1S/C27H26N4O5S2/c1-33-13-12-29-38-20-10-6-18(7-11-20)25(36-19-8-4-17(16-28)5-9-19)26(32)31-27-30-21-14-22(34-2)23(35-3)15-24(21)37-27/h4-11,14-15,25,29H,12-13H2,1-3H3,(H,30,31,32) |
| InChIKey | NWMAMWHQDWUYDU-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 114.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.66 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|