C9H14N2O — CID 134479515
(Z)-N-(cyclopropylmethyl)-2-iminopent-3-enamide (PubChem CID 134479515) has the molecular formula C9H14N2O and a molecular weight of 166.22 g/mol. Its IUPAC name is (Z)-N-(cyclopropylmethyl)-2-iminopent-3-enamide.
| Compound Name | (Z)-N-(cyclopropylmethyl)-2-iminopent-3-enamide |
|---|---|
| PubChem CID | 134479515 |
| Molecular Formula | C9H14N2O |
| Molecular Weight | 166.22 g/mol |
| Exact Mass | 166.11 |
| IUPAC Name | (Z)-N-(cyclopropylmethyl)-2-iminopent-3-enamide |
| SMILES | [H]/N=C(\C=C/C)C(=O)NCC1CC1 |
| InChI | InChI=1S/C9H14N2O/c1-2-3-8(10)9(12)11-6-7-4-5-7/h2-3,7,10H,4-6H2,1H3,(H,11,12)/b3-2-,10-8+ |
| InChIKey | USMJKQOVVBQUBL-QQOOZTEWSA-N |
| XLogP | 1.11 |
| TPSA | 52.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.22 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|