C6H8N2O — CID 123178649
6-imino-2,3-dihydro-1H-azepin-7-one (PubChem CID 123178649) has the molecular formula C6H8N2O and a molecular weight of 124.14 g/mol. Its IUPAC name is 6-imino-2,3-dihydro-1H-azepin-7-one.
| Compound Name | 6-imino-2,3-dihydro-1H-azepin-7-one |
|---|---|
| PubChem CID | 123178649 |
| Molecular Formula | C6H8N2O |
| Molecular Weight | 124.14 g/mol |
| Exact Mass | 124.06 |
| IUPAC Name | 6-imino-2,3-dihydro-1H-azepin-7-one |
| SMILES | [H]/N=C1\C=CCCNC1=O |
| InChI | InChI=1S/C6H8N2O/c7-5-3-1-2-4-8-6(5)9/h1,3,7H,2,4H2,(H,8,9)/b7-5+ |
| InChIKey | JGCUSWNXSXKWEZ-FNORWQNLSA-N |
| XLogP | 0.08 |
| TPSA | 52.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 124.14 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|