C8H13N3O — CID 143114264
N-(2-aminoethyl)-2,3-dihydropyridine-6-carboxamide (PubChem CID 143114264) has the molecular formula C8H13N3O and a molecular weight of 167.21 g/mol. Its IUPAC name is N-(2-aminoethyl)-2,3-dihydropyridine-6-carboxamide.
| Compound Name | N-(2-aminoethyl)-2,3-dihydropyridine-6-carboxamide |
|---|---|
| PubChem CID | 143114264 |
| Molecular Formula | C8H13N3O |
| Molecular Weight | 167.21 g/mol |
| Exact Mass | 167.11 |
| IUPAC Name | N-(2-aminoethyl)-2,3-dihydropyridine-6-carboxamide |
| SMILES | NCCNC(=O)C1=NCCC=C1 |
| InChI | InChI=1S/C8H13N3O/c9-4-6-11-8(12)7-3-1-2-5-10-7/h1,3H,2,4-6,9H2,(H,11,12) |
| InChIKey | PVMMOOHCVBVEBZ-UHFFFAOYSA-N |
| XLogP | -0.54 |
| TPSA | 67.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.21 |
| LogP ≤ 5 | -0.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |