C11H18N2O — CID 91391690
N-(2,3-dihydropyridin-6-ylmethyl)pentanamide (PubChem CID 91391690) has the molecular formula C11H18N2O and a molecular weight of 194.28 g/mol. Its IUPAC name is N-(2,3-dihydropyridin-6-ylmethyl)pentanamide.
| Compound Name | N-(2,3-dihydropyridin-6-ylmethyl)pentanamide |
|---|---|
| PubChem CID | 91391690 |
| Molecular Formula | C11H18N2O |
| Molecular Weight | 194.28 g/mol |
| Exact Mass | 194.14 |
| IUPAC Name | N-(2,3-dihydropyridin-6-ylmethyl)pentanamide |
| SMILES | CCCCC(=O)NCC1=NCCC=C1 |
| InChI | InChI=1S/C11H18N2O/c1-2-3-7-11(14)13-9-10-6-4-5-8-12-10/h4,6H,2-3,5,7-9H2,1H3,(H,13,14) |
| InChIKey | LIIIVLXVMBXIHM-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.28 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |