C11H18N2O — CID 91425388
3-prop-1-enyl-5,6,7,8,9,10-hexahydro-1H-1,4-diazecin-2-one (PubChem CID 91425388) has the molecular formula C11H18N2O and a molecular weight of 194.28 g/mol. Its IUPAC name is 3-prop-1-enyl-5,6,7,8,9,10-hexahydro-1H-1,4-diazecin-2-one.
| Compound Name | 3-prop-1-enyl-5,6,7,8,9,10-hexahydro-1H-1,4-diazecin-2-one |
|---|---|
| PubChem CID | 91425388 |
| Molecular Formula | C11H18N2O |
| Molecular Weight | 194.28 g/mol |
| Exact Mass | 194.14 |
| IUPAC Name | 3-prop-1-enyl-5,6,7,8,9,10-hexahydro-1H-1,4-diazecin-2-one |
| SMILES | CC=C/C1=N/CCCCCCNC1=O |
| InChI | InChI=1S/C11H18N2O/c1-2-7-10-11(14)13-9-6-4-3-5-8-12-10/h2,7H,3-6,8-9H2,1H3,(H,13,14)/b7-2?,12-10- |
| InChIKey | WKXUXDWLZJFFCV-GHACNSAASA-N |
| XLogP | 1.69 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.28 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |