C13H25NO2 — CID 134479837
5-(2-hydroxyethoxy)-3,3,6,6-tetramethylheptanenitrile (PubChem CID 134479837) has the molecular formula C13H25NO2 and a molecular weight of 227.35 g/mol. Its IUPAC name is 5-(2-hydroxyethoxy)-3,3,6,6-tetramethylheptanenitrile.
| Compound Name | 5-(2-hydroxyethoxy)-3,3,6,6-tetramethylheptanenitrile |
|---|---|
| PubChem CID | 134479837 |
| Molecular Formula | C13H25NO2 |
| Molecular Weight | 227.35 g/mol |
| Exact Mass | 227.19 |
| IUPAC Name | 5-(2-hydroxyethoxy)-3,3,6,6-tetramethylheptanenitrile |
| SMILES | CC(C)(CC#N)CC(OCCO)C(C)(C)C |
| InChI | InChI=1S/C13H25NO2/c1-12(2,3)11(16-9-8-15)10-13(4,5)6-7-14/h11,15H,6,8-10H2,1-5H3 |
| InChIKey | VKHXLDNADOGLOE-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 53.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.35 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |