C36H42N6O7 — CID 134479890
1-[(2S,3S)-2-amino-3-methylpentanoyl]oxyethyl 3-[2-[(4-carbamimidoylphenyl)carbamoyl]-4-ethenyl-5-methoxyphenyl]-6-(cyclopropylmethylcarbamoyl)pyridine-2-carboxylate (PubChem CID 134479890) has the molecular formula C36H42N6O7 and a molecular weight of 670.77 g/mol. Its IUPAC name is 1-[(2S,3S)-2-amino-3-methylpentanoyl]oxyethyl 3-[2-[(4-carbamimidoylphenyl)carbamoyl]-4-ethenyl-5-methoxyphenyl]-6-(cyclopropylmethylcarbamoyl)pyridine-2-carboxylate.
| Compound Name | 1-[(2S,3S)-2-amino-3-methylpentanoyl]oxyethyl 3-[2-[(4-carbamimidoylphenyl)carbamoyl]-4-ethenyl-5-methoxyphenyl]-6-(cyclopropylmethylcarbamoyl)pyridine-2-carboxylate |
|---|---|
| PubChem CID | 134479890 |
| Molecular Formula | C36H42N6O7 |
| Molecular Weight | 670.77 g/mol |
| Exact Mass | 670.31 |
| IUPAC Name | 1-[(2S,3S)-2-amino-3-methylpentanoyl]oxyethyl 3-[2-[(4-carbamimidoylphenyl)carbamoyl]-4-ethenyl-5-methoxyphenyl]-6-(cyclopropylmethylcarbamoyl)pyridine-2-carboxylate |
| SMILES | [H]/N=C(\N)c1ccc(NC(=O)c2cc(C=C)c(OC)cc2-c2ccc(C(=O)NCC3CC3)nc2C(=O)OC(C)OC(=O)[C@@H](N)[C@@H](C)CC)cc1 |
| InChI | InChI=1S/C36H42N6O7/c1-6-19(3)30(37)35(45)48-20(4)49-36(46)31-25(14-15-28(42-31)34(44)40-18-21-8-9-21)26-17-29(47-5)22(7-2)16-27(26)33(43)41-24-12-10-23(11-13-24)32(38)39/h7,10-17,19-21,30H,2,6,8-9,18,37H2,1,3-5H3,(H3,38,39)(H,40,44)(H,41,43)/t19-,20?,30-/m0/s1 |
| InChIKey | NLHPYTJOUCYZEV-SZGZLSOASA-N |
| XLogP | 4.50 |
| TPSA | 208.81 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 49 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 670.77 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|