C31H33Cl4N5O6 — CID 155070328
chloroform;2-hydroxyethyl 3-[2-[(4-carbamimidoylphenyl)carbamoyl]-4-ethenyl-5-methoxyphenyl]-6-(cyclopropylmethylcarbamoyl)pyridine-2-carboxylate;hydrochloride (PubChem CID 155070328) has the molecular formula C31H33Cl4N5O6 and a molecular weight of 713.45 g/mol. Its IUPAC name is chloroform;2-hydroxyethyl 3-[2-[(4-carbamimidoylphenyl)carbamoyl]-4-ethenyl-5-methoxyphenyl]-6-(cyclopropylmethylcarbamoyl)pyridine-2-carboxylate;hydrochloride.
| Compound Name | chloroform;2-hydroxyethyl 3-[2-[(4-carbamimidoylphenyl)carbamoyl]-4-ethenyl-5-methoxyphenyl]-6-(cyclopropylmethylcarbamoyl)pyridine-2-carboxylate;hydrochloride |
|---|---|
| PubChem CID | 155070328 |
| Molecular Formula | C31H33Cl4N5O6 |
| Molecular Weight | 713.45 g/mol |
| Exact Mass | 711.12 |
| IUPAC Name | chloroform;2-hydroxyethyl 3-[2-[(4-carbamimidoylphenyl)carbamoyl]-4-ethenyl-5-methoxyphenyl]-6-(cyclopropylmethylcarbamoyl)pyridine-2-carboxylate;hydrochloride |
| SMILES | Cl.ClC(Cl)Cl.[H]/N=C(\N)c1ccc(NC(=O)c2cc(C=C)c(OC)cc2-c2ccc(C(=O)NCC3CC3)nc2C(=O)OCCO)cc1 |
| InChI | InChI=1S/C30H31N5O6.CHCl3.ClH/c1-3-18-14-23(28(37)34-20-8-6-19(7-9-20)27(31)32)22(15-25(18)40-2)21-10-11-24(29(38)33-16-17-4-5-17)35-26(21)30(39)41-13-12-36;2-1(3)4;/h3,6-11,14-15,17,36H,1,4-5,12-13,16H2,2H3,(H3,31,32)(H,33,38)(H,34,37);1H;1H |
| InChIKey | SZLCLRBHOCTIAB-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 176.72 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 713.45 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|