C30H31N5O6 — CID 134479751
ethyl 6-(cyclopropylmethylcarbamoyl)-3-[4-ethenyl-2-[[4-[(Z)-N'-hydroxycarbamimidoyl]phenyl]carbamoyl]-5-methoxyphenyl]pyridine-2-carboxylate (PubChem CID 134479751) has the molecular formula C30H31N5O6 and a molecular weight of 557.61 g/mol. Its IUPAC name is ethyl 6-(cyclopropylmethylcarbamoyl)-3-[4-ethenyl-2-[[4-[(Z)-N'-hydroxycarbamimidoyl]phenyl]carbamoyl]-5-methoxyphenyl]pyridine-2-carboxylate.
| Compound Name | ethyl 6-(cyclopropylmethylcarbamoyl)-3-[4-ethenyl-2-[[4-[(Z)-N'-hydroxycarbamimidoyl]phenyl]carbamoyl]-5-methoxyphenyl]pyridine-2-carboxylate |
|---|---|
| PubChem CID | 134479751 |
| Molecular Formula | C30H31N5O6 |
| Molecular Weight | 557.61 g/mol |
| Exact Mass | 557.23 |
| IUPAC Name | ethyl 6-(cyclopropylmethylcarbamoyl)-3-[4-ethenyl-2-[[4-[(Z)-N'-hydroxycarbamimidoyl]phenyl]carbamoyl]-5-methoxyphenyl]pyridine-2-carboxylate |
| SMILES | C=Cc1cc(C(=O)Nc2ccc(/C(N)=N/O)cc2)c(-c2ccc(C(=O)NCC3CC3)nc2C(=O)OCC)cc1OC |
| InChI | InChI=1S/C30H31N5O6/c1-4-18-14-23(28(36)33-20-10-8-19(9-11-20)27(31)35-39)22(15-25(18)40-3)21-12-13-24(29(37)32-16-17-6-7-17)34-26(21)30(38)41-5-2/h4,8-15,17,39H,1,5-7,16H2,2-3H3,(H2,31,35)(H,32,37)(H,33,36) |
| InChIKey | SPWIXDBEIMMNFX-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 165.23 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.61 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|