C35H39N5O7 — CID 147694306
2-morpholin-4-ylethyl 6-(cyclopropylmethylcarbamoyl)-3-[4-ethenyl-2-[2-[4-(N'-hydroxycarbamimidoyl)phenyl]acetyl]-5-methoxyphenyl]pyridine-2-carboxylate (PubChem CID 147694306) has the molecular formula C35H39N5O7 and a molecular weight of 641.73 g/mol. Its IUPAC name is 2-morpholin-4-ylethyl 6-(cyclopropylmethylcarbamoyl)-3-[4-ethenyl-2-[2-[4-(N'-hydroxycarbamimidoyl)phenyl]acetyl]-5-methoxyphenyl]pyridine-2-carboxylate.
| Compound Name | 2-morpholin-4-ylethyl 6-(cyclopropylmethylcarbamoyl)-3-[4-ethenyl-2-[2-[4-(N'-hydroxycarbamimidoyl)phenyl]acetyl]-5-methoxyphenyl]pyridine-2-carboxylate |
|---|---|
| PubChem CID | 147694306 |
| Molecular Formula | C35H39N5O7 |
| Molecular Weight | 641.73 g/mol |
| Exact Mass | 641.28 |
| IUPAC Name | 2-morpholin-4-ylethyl 6-(cyclopropylmethylcarbamoyl)-3-[4-ethenyl-2-[2-[4-(N'-hydroxycarbamimidoyl)phenyl]acetyl]-5-methoxyphenyl]pyridine-2-carboxylate |
| SMILES | C=Cc1cc(C(=O)Cc2ccc(C(N)=NO)cc2)c(-c2ccc(C(=O)NCC3CC3)nc2C(=O)OCCN2CCOCC2)cc1OC |
| InChI | InChI=1S/C35H39N5O7/c1-3-24-19-28(30(41)18-22-6-8-25(9-7-22)33(36)39-44)27(20-31(24)45-2)26-10-11-29(34(42)37-21-23-4-5-23)38-32(26)35(43)47-17-14-40-12-15-46-16-13-40/h3,6-11,19-20,23,44H,1,4-5,12-18,21H2,2H3,(H2,36,39)(H,37,42) |
| InChIKey | GROWWYJEQYVOJH-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 165.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.73 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|