C34H40N6O7 — CID 156546301
2-morpholin-4-ylethyl 6-[(cyclopropylmethylamino)-hydroxymethyl]-3-[4-ethenyl-2-[[4-[(Z)-N'-hydroxycarbamimidoyl]phenyl]carbamoyl]-5-methoxyphenyl]pyridine-2-carboxylate (PubChem CID 156546301) has the molecular formula C34H40N6O7 and a molecular weight of 644.73 g/mol. Its IUPAC name is 2-morpholin-4-ylethyl 6-[(cyclopropylmethylamino)-hydroxymethyl]-3-[4-ethenyl-2-[[4-[(Z)-N'-hydroxycarbamimidoyl]phenyl]carbamoyl]-5-methoxyphenyl]pyridine-2-carboxylate.
| Compound Name | 2-morpholin-4-ylethyl 6-[(cyclopropylmethylamino)-hydroxymethyl]-3-[4-ethenyl-2-[[4-[(Z)-N'-hydroxycarbamimidoyl]phenyl]carbamoyl]-5-methoxyphenyl]pyridine-2-carboxylate |
|---|---|
| PubChem CID | 156546301 |
| Molecular Formula | C34H40N6O7 |
| Molecular Weight | 644.73 g/mol |
| Exact Mass | 644.30 |
| IUPAC Name | 2-morpholin-4-ylethyl 6-[(cyclopropylmethylamino)-hydroxymethyl]-3-[4-ethenyl-2-[[4-[(Z)-N'-hydroxycarbamimidoyl]phenyl]carbamoyl]-5-methoxyphenyl]pyridine-2-carboxylate |
| SMILES | C=Cc1cc(C(=O)Nc2ccc(/C(N)=N/O)cc2)c(-c2ccc(C(O)NCC3CC3)nc2C(=O)OCCN2CCOCC2)cc1OC |
| InChI | InChI=1S/C34H40N6O7/c1-3-22-18-27(32(41)37-24-8-6-23(7-9-24)31(35)39-44)26(19-29(22)45-2)25-10-11-28(33(42)36-20-21-4-5-21)38-30(25)34(43)47-17-14-40-12-15-46-16-13-40/h3,6-11,18-19,21,33,36,42,44H,1,4-5,12-17,20H2,2H3,(H2,35,39)(H,37,41) |
| InChIKey | ZIBQWJRDSWKZSS-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 180.86 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.73 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|