C29H29N5O5 — CID 118878592
methyl 3-[2-[(4-carbamimidoylphenyl)carbamoyl]-4-ethenyl-5-methoxyphenyl]-6-[cyclopropyl(methyl)carbamoyl]pyridine-2-carboxylate (PubChem CID 118878592) has the molecular formula C29H29N5O5 and a molecular weight of 527.58 g/mol. Its IUPAC name is methyl 3-[2-[(4-carbamimidoylphenyl)carbamoyl]-4-ethenyl-5-methoxyphenyl]-6-[cyclopropyl(methyl)carbamoyl]pyridine-2-carboxylate.
| Compound Name | methyl 3-[2-[(4-carbamimidoylphenyl)carbamoyl]-4-ethenyl-5-methoxyphenyl]-6-[cyclopropyl(methyl)carbamoyl]pyridine-2-carboxylate |
|---|---|
| PubChem CID | 118878592 |
| Molecular Formula | C29H29N5O5 |
| Molecular Weight | 527.58 g/mol |
| Exact Mass | 527.22 |
| IUPAC Name | methyl 3-[2-[(4-carbamimidoylphenyl)carbamoyl]-4-ethenyl-5-methoxyphenyl]-6-[cyclopropyl(methyl)carbamoyl]pyridine-2-carboxylate |
| SMILES | [H]/N=C(\N)c1ccc(NC(=O)c2cc(C=C)c(OC)cc2-c2ccc(C(=O)N(C)C3CC3)nc2C(=O)OC)cc1 |
| InChI | InChI=1S/C29H29N5O5/c1-5-16-14-22(27(35)32-18-8-6-17(7-9-18)26(30)31)21(15-24(16)38-3)20-12-13-23(33-25(20)29(37)39-4)28(36)34(2)19-10-11-19/h5-9,12-15,19H,1,10-11H2,2-4H3,(H3,30,31)(H,32,35) |
| InChIKey | AQXCGPMFOWAXDX-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 147.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.58 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|