C9H17N3 — CID 134480022
(Z)-2-methylimino-N'-propylpent-3-enimidamide (PubChem CID 134480022) has the molecular formula C9H17N3 and a molecular weight of 167.26 g/mol. Its IUPAC name is (Z)-2-methylimino-N'-propylpent-3-enimidamide.
| Compound Name | (Z)-2-methylimino-N'-propylpent-3-enimidamide |
|---|---|
| PubChem CID | 134480022 |
| Molecular Formula | C9H17N3 |
| Molecular Weight | 167.26 g/mol |
| Exact Mass | 167.14 |
| IUPAC Name | (Z)-2-methylimino-N'-propylpent-3-enimidamide |
| SMILES | C/C=C\C(=N/C)\C(N)=N\CCC |
| InChI | InChI=1S/C9H17N3/c1-4-6-8(11-3)9(10)12-7-5-2/h4,6H,5,7H2,1-3H3,(H2,10,12)/b6-4-,11-8+ |
| InChIKey | RBDCDZCYRIFYTF-XSMBNUTRSA-N |
| XLogP | 1.40 |
| TPSA | 50.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.26 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|