C6H10N2O3 — CID 134482060
2-(1-hydroxy-2-methyl-4,5-dihydroimidazol-1-ium-1-yl)acetate (PubChem CID 134482060) has the molecular formula C6H10N2O3 and a molecular weight of 158.16 g/mol. Its IUPAC name is 2-(1-hydroxy-2-methyl-4,5-dihydroimidazol-1-ium-1-yl)acetate.
| Compound Name | 2-(1-hydroxy-2-methyl-4,5-dihydroimidazol-1-ium-1-yl)acetate |
|---|---|
| PubChem CID | 134482060 |
| Molecular Formula | C6H10N2O3 |
| Molecular Weight | 158.16 g/mol |
| Exact Mass | 158.07 |
| IUPAC Name | 2-(1-hydroxy-2-methyl-4,5-dihydroimidazol-1-ium-1-yl)acetate |
| SMILES | CC1=NCC[N+]1(O)CC(=O)[O-] |
| InChI | InChI=1S/C6H10N2O3/c1-5-7-2-3-8(5,11)4-6(9)10/h11H,2-4H2,1H3 |
| InChIKey | XCVYEKXZQHODCC-UHFFFAOYSA-N |
| XLogP | -1.63 |
| TPSA | 72.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.16 |
| LogP ≤ 5 | -1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|