About 2-(1-hydroxy-2-methyl-4,5-dihydroimidazol-1-ium-1-yl)acetate
2-(1-hydroxy-2-methyl-4,5-dihydroimidazol-1-ium-1-yl)acetate (PubChem CID 134482060) has the molecular formula C6H10N2O3
and a molecular weight of 158.16 g/mol. Its IUPAC name is 2-(1-hydroxy-2-methyl-4,5-dihydroimidazol-1-ium-1-yl)acetate.
Molecular Properties
| Compound Name | 2-(1-hydroxy-2-methyl-4,5-dihydroimidazol-1-ium-1-yl)acetate |
| PubChem CID | 134482060 |
| Molecular Formula | C6H10N2O3 |
| Molecular Weight | 158.16 g/mol |
| Exact Mass | 158.07 |
| IUPAC Name | 2-(1-hydroxy-2-methyl-4,5-dihydroimidazol-1-ium-1-yl)acetate |
| SMILES | CC1=NCC[N+]1(O)CC(=O)[O-] |
| InChI | InChI=1S/C6H10N2O3/c1-5-7-2-3-8(5,11)4-6(9)10/h11H,2-4H2,1H3 |
| InChIKey | XCVYEKXZQHODCC-UHFFFAOYSA-N |
| XLogP | -1.63 |
| TPSA | 72.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 158.16 |
| LogP ≤ 5 | -1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze 2-(1-hydroxy-2-methyl-4,5-dihydroimidazol-1-ium-1-yl)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1-hydroxy-2-methyl-4,5-dihydroimidazol-1-ium-1-yl)acetate?
The IUPAC name of 2-(1-hydroxy-2-methyl-4,5-dihydroimidazol-1-ium-1-yl)acetate (CID 134482060) is 2-(1-hydroxy-2-methyl-4,5-dihydroimidazol-1-ium-1-yl)acetate.
What is the SMILES notation for 2-(1-hydroxy-2-methyl-4,5-dihydroimidazol-1-ium-1-yl)acetate?
The canonical SMILES for 2-(1-hydroxy-2-methyl-4,5-dihydroimidazol-1-ium-1-yl)acetate is CC1=NCC[N+]1(O)CC(=O)[O-].
What is the InChIKey of 2-(1-hydroxy-2-methyl-4,5-dihydroimidazol-1-ium-1-yl)acetate?
The InChIKey is XCVYEKXZQHODCC-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10N2O3/c1-5-7-2-3-8(5,11)4-6(9)10/h11H,2-4H2,1H3.
What are the key properties of 2-(1-hydroxy-2-methyl-4,5-dihydroimidazol-1-ium-1-yl)acetate?
2-(1-hydroxy-2-methyl-4,5-dihydroimidazol-1-ium-1-yl)acetate has a molecular weight of 158.16 g/mol, XLogP of -1.63, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1-hydroxy-2-methyl-4,5-dihydroimidazol-1-ium-1-yl)acetate is sourced from PubChem (CID 134482060), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).