C29H31N5O3 — CID 134482158
[(1S,5R,8R)-6-azatricyclo[3.2.1.03,8]octan-6-yl]-[2-[1-(cyclopropylmethyl)-6-methoxypyrrolo[2,3-b]pyridin-2-yl]-7-methoxy-1-methylbenzimidazol-5-yl]methanone (PubChem CID 134482158) has the molecular formula C29H31N5O3 and a molecular weight of 497.60 g/mol. Its IUPAC name is [(1S,5R,8R)-6-azatricyclo[3.2.1.03,8]octan-6-yl]-[2-[1-(cyclopropylmethyl)-6-methoxypyrrolo[2,3-b]pyridin-2-yl]-7-methoxy-1-methylbenzimidazol-5-yl]methanone.
| Compound Name | [(1S,5R,8R)-6-azatricyclo[3.2.1.03,8]octan-6-yl]-[2-[1-(cyclopropylmethyl)-6-methoxypyrrolo[2,3-b]pyridin-2-yl]-7-methoxy-1-methylbenzimidazol-5-yl]methanone |
|---|---|
| PubChem CID | 134482158 |
| Molecular Formula | C29H31N5O3 |
| Molecular Weight | 497.60 g/mol |
| Exact Mass | 497.24 |
| IUPAC Name | [(1S,5R,8R)-6-azatricyclo[3.2.1.03,8]octan-6-yl]-[2-[1-(cyclopropylmethyl)-6-methoxypyrrolo[2,3-b]pyridin-2-yl]-7-methoxy-1-methylbenzimidazol-5-yl]methanone |
| SMILES | COc1ccc2cc(-c3nc4cc(C(=O)N5C[C@H]6CC7C[C@@H]5[C@H]76)cc(OC)c4n3C)n(CC3CC3)c2n1 |
| InChI | InChI=1S/C29H31N5O3/c1-32-26-20(9-18(12-23(26)36-2)29(35)34-14-19-8-17-11-21(34)25(17)19)30-28(32)22-10-16-6-7-24(37-3)31-27(16)33(22)13-15-4-5-15/h6-7,9-10,12,15,17,19,21,25H,4-5,8,11,13-14H2,1-3H3/t17?,19-,21-,25-/m1/s1 |
| InChIKey | QAZGHLSNHIJOFB-SEOGEUHDSA-N |
| XLogP | 4.50 |
| TPSA | 74.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.60 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |