C28H30FN5O3 — CID 166764142
[(1S,5R,8R)-6-azatricyclo[3.2.1.03,8]octan-6-yl]-[2-[1-ethyl-6-(1-fluoroethoxy)pyrrolo[2,3-b]pyridin-2-yl]-7-methoxy-1-methylbenzimidazol-5-yl]methanone (PubChem CID 166764142) has the molecular formula C28H30FN5O3 and a molecular weight of 503.58 g/mol. Its IUPAC name is [(1S,5R,8R)-6-azatricyclo[3.2.1.03,8]octan-6-yl]-[2-[1-ethyl-6-(1-fluoroethoxy)pyrrolo[2,3-b]pyridin-2-yl]-7-methoxy-1-methylbenzimidazol-5-yl]methanone.
| Compound Name | [(1S,5R,8R)-6-azatricyclo[3.2.1.03,8]octan-6-yl]-[2-[1-ethyl-6-(1-fluoroethoxy)pyrrolo[2,3-b]pyridin-2-yl]-7-methoxy-1-methylbenzimidazol-5-yl]methanone |
|---|---|
| PubChem CID | 166764142 |
| Molecular Formula | C28H30FN5O3 |
| Molecular Weight | 503.58 g/mol |
| Exact Mass | 503.23 |
| IUPAC Name | [(1S,5R,8R)-6-azatricyclo[3.2.1.03,8]octan-6-yl]-[2-[1-ethyl-6-(1-fluoroethoxy)pyrrolo[2,3-b]pyridin-2-yl]-7-methoxy-1-methylbenzimidazol-5-yl]methanone |
| SMILES | CCn1c(-c2nc3cc(C(=O)N4C[C@H]5CC6C[C@@H]4[C@H]65)cc(OC)c3n2C)cc2ccc(OC(C)F)nc21 |
| InChI | InChI=1S/C28H30FN5O3/c1-5-33-21(10-15-6-7-23(31-26(15)33)37-14(2)29)27-30-19-9-17(12-22(36-4)25(19)32(27)3)28(35)34-13-18-8-16-11-20(34)24(16)18/h6-7,9-10,12,14,16,18,20,24H,5,8,11,13H2,1-4H3/t14?,16?,18-,20-,24-/m1/s1 |
| InChIKey | LOSXUJPAUJIRGM-BYQVDONQSA-N |
| XLogP | 4.79 |
| TPSA | 74.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.58 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |