About [cyclohexyl(piperidin-2-yl)methyl] 2-iodopropanoate
[cyclohexyl(piperidin-2-yl)methyl] 2-iodopropanoate (PubChem CID 134485571) has the molecular formula C15H26INO2
and a molecular weight of 379.28 g/mol. Its IUPAC name is [cyclohexyl(piperidin-2-yl)methyl] 2-iodopropanoate.
Molecular Properties
| Compound Name | [cyclohexyl(piperidin-2-yl)methyl] 2-iodopropanoate |
| PubChem CID | 134485571 |
| Molecular Formula | C15H26INO2 |
| Molecular Weight | 379.28 g/mol |
| Exact Mass | 379.10 |
| IUPAC Name | [cyclohexyl(piperidin-2-yl)methyl] 2-iodopropanoate |
| SMILES | CC(I)C(=O)OC(C1CCCCC1)C1CCCCN1 |
| InChI | InChI=1S/C15H26INO2/c1-11(16)15(18)19-14(12-7-3-2-4-8-12)13-9-5-6-10-17-13/h11-14,17H,2-10H2,1H3 |
| InChIKey | ISCHAVPTZOZDMG-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 379.28 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze [cyclohexyl(piperidin-2-yl)methyl] 2-iodopropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [cyclohexyl(piperidin-2-yl)methyl] 2-iodopropanoate?
The IUPAC name of [cyclohexyl(piperidin-2-yl)methyl] 2-iodopropanoate (CID 134485571) is [cyclohexyl(piperidin-2-yl)methyl] 2-iodopropanoate.
What is the SMILES notation for [cyclohexyl(piperidin-2-yl)methyl] 2-iodopropanoate?
The canonical SMILES for [cyclohexyl(piperidin-2-yl)methyl] 2-iodopropanoate is CC(I)C(=O)OC(C1CCCCC1)C1CCCCN1.
What is the InChIKey of [cyclohexyl(piperidin-2-yl)methyl] 2-iodopropanoate?
The InChIKey is ISCHAVPTZOZDMG-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H26INO2/c1-11(16)15(18)19-14(12-7-3-2-4-8-12)13-9-5-6-10-17-13/h11-14,17H,2-10H2,1H3.
What are the key properties of [cyclohexyl(piperidin-2-yl)methyl] 2-iodopropanoate?
[cyclohexyl(piperidin-2-yl)methyl] 2-iodopropanoate has a molecular weight of 379.28 g/mol, XLogP of 3.44, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [cyclohexyl(piperidin-2-yl)methyl] 2-iodopropanoate is sourced from PubChem (CID 134485571), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).