About dicyclohexylmethyl 2-[(2-methylpropan-2-yl)oxy]propanoate
dicyclohexylmethyl 2-[(2-methylpropan-2-yl)oxy]propanoate (PubChem CID 158607221) has the molecular formula C20H36O3
and a molecular weight of 324.50 g/mol. Its IUPAC name is dicyclohexylmethyl 2-[(2-methylpropan-2-yl)oxy]propanoate.
Molecular Properties
| Compound Name | dicyclohexylmethyl 2-[(2-methylpropan-2-yl)oxy]propanoate |
| PubChem CID | 158607221 |
| Molecular Formula | C20H36O3 |
| Molecular Weight | 324.50 g/mol |
| Exact Mass | 324.27 |
| IUPAC Name | dicyclohexylmethyl 2-[(2-methylpropan-2-yl)oxy]propanoate |
| SMILES | CC(OC(C)(C)C)C(=O)OC(C1CCCCC1)C1CCCCC1 |
| InChI | InChI=1S/C20H36O3/c1-15(23-20(2,3)4)19(21)22-18(16-11-7-5-8-12-16)17-13-9-6-10-14-17/h15-18H,5-14H2,1-4H3 |
| InChIKey | CWHBBCOUDMNFPQ-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 324.50 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze dicyclohexylmethyl 2-[(2-methylpropan-2-yl)oxy]propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dicyclohexylmethyl 2-[(2-methylpropan-2-yl)oxy]propanoate?
The IUPAC name of dicyclohexylmethyl 2-[(2-methylpropan-2-yl)oxy]propanoate (CID 158607221) is dicyclohexylmethyl 2-[(2-methylpropan-2-yl)oxy]propanoate.
What is the SMILES notation for dicyclohexylmethyl 2-[(2-methylpropan-2-yl)oxy]propanoate?
The canonical SMILES for dicyclohexylmethyl 2-[(2-methylpropan-2-yl)oxy]propanoate is CC(OC(C)(C)C)C(=O)OC(C1CCCCC1)C1CCCCC1.
What is the InChIKey of dicyclohexylmethyl 2-[(2-methylpropan-2-yl)oxy]propanoate?
The InChIKey is CWHBBCOUDMNFPQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H36O3/c1-15(23-20(2,3)4)19(21)22-18(16-11-7-5-8-12-16)17-13-9-6-10-14-17/h15-18H,5-14H2,1-4H3.
What are the key properties of dicyclohexylmethyl 2-[(2-methylpropan-2-yl)oxy]propanoate?
dicyclohexylmethyl 2-[(2-methylpropan-2-yl)oxy]propanoate has a molecular weight of 324.50 g/mol, XLogP of 5.26, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for dicyclohexylmethyl 2-[(2-methylpropan-2-yl)oxy]propanoate is sourced from PubChem (CID 158607221), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).