C28H45NO — CID 134486601
1-but-3-enyl-2,2,6,6-tetramethyl-4-[4-(4-propoxycyclohexyl)phenyl]piperidine (PubChem CID 134486601) has the molecular formula C28H45NO and a molecular weight of 411.67 g/mol. Its IUPAC name is 1-but-3-enyl-2,2,6,6-tetramethyl-4-[4-(4-propoxycyclohexyl)phenyl]piperidine.
| Compound Name | 1-but-3-enyl-2,2,6,6-tetramethyl-4-[4-(4-propoxycyclohexyl)phenyl]piperidine |
|---|---|
| PubChem CID | 134486601 |
| Molecular Formula | C28H45NO |
| Molecular Weight | 411.67 g/mol |
| Exact Mass | 411.35 |
| IUPAC Name | 1-but-3-enyl-2,2,6,6-tetramethyl-4-[4-(4-propoxycyclohexyl)phenyl]piperidine |
| SMILES | C=CCCN1C(C)(C)CC(c2ccc(C3CCC(OCCC)CC3)cc2)CC1(C)C |
| InChI | InChI=1S/C28H45NO/c1-7-9-18-29-27(3,4)20-25(21-28(29,5)6)24-12-10-22(11-13-24)23-14-16-26(17-15-23)30-19-8-2/h7,10-13,23,25-26H,1,8-9,14-21H2,2-6H3 |
| InChIKey | HFRXITCNGUDFCN-UHFFFAOYSA-N |
| XLogP | 7.45 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.67 |
| LogP ≤ 5 | 7.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|