C21H33NO — CID 44563686
2-[3-(3-phenylpropoxy)propyl]-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinoline (PubChem CID 44563686) has the molecular formula C21H33NO and a molecular weight of 315.50 g/mol. Its IUPAC name is 2-[3-(3-phenylpropoxy)propyl]-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinoline.
| Compound Name | 2-[3-(3-phenylpropoxy)propyl]-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinoline |
|---|---|
| PubChem CID | 44563686 |
| Molecular Formula | C21H33NO |
| Molecular Weight | 315.50 g/mol |
| Exact Mass | 315.26 |
| IUPAC Name | 2-[3-(3-phenylpropoxy)propyl]-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinoline |
| SMILES | c1ccc(CCCOCCCN2CCC3CCCCC3C2)cc1 |
| InChI | InChI=1S/C21H33NO/c1-2-8-19(9-3-1)10-6-16-23-17-7-14-22-15-13-20-11-4-5-12-21(20)18-22/h1-3,8-9,20-21H,4-7,10-18H2 |
| InChIKey | GORIVPRCNIUNIA-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.50 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|