About 2-methylpropyl 5-[2-[2-[2-[[4-(2-methylpropoxy)-4-oxobutyl]amino]ethoxy]ethoxy]ethylamino]pentanoate
2-methylpropyl 5-[2-[2-[2-[[4-(2-methylpropoxy)-4-oxobutyl]amino]ethoxy]ethoxy]ethylamino]pentanoate (PubChem CID 134487391) has the molecular formula C23H46N2O6
and a molecular weight of 446.63 g/mol. Its IUPAC name is 2-methylpropyl 5-[2-[2-[2-[[4-(2-methylpropoxy)-4-oxobutyl]amino]ethoxy]ethoxy]ethylamino]pentanoate.
Molecular Properties
| Compound Name | 2-methylpropyl 5-[2-[2-[2-[[4-(2-methylpropoxy)-4-oxobutyl]amino]ethoxy]ethoxy]ethylamino]pentanoate |
| PubChem CID | 134487391 |
| Molecular Formula | C23H46N2O6 |
| Molecular Weight | 446.63 g/mol |
| Exact Mass | 446.34 |
| IUPAC Name | 2-methylpropyl 5-[2-[2-[2-[[4-(2-methylpropoxy)-4-oxobutyl]amino]ethoxy]ethoxy]ethylamino]pentanoate |
| SMILES | CC(C)COC(=O)CCCCNCCOCCOCCNCCCC(=O)OCC(C)C |
| InChI | InChI=1S/C23H46N2O6/c1-20(2)18-30-22(26)8-5-6-10-24-12-14-28-16-17-29-15-13-25-11-7-9-23(27)31-19-21(3)4/h20-21,24-25H,5-19H2,1-4H3 |
| InChIKey | KFCBOASMRXQMLT-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 95.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 446.63 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-methylpropyl 5-[2-[2-[2-[[4-(2-methylpropoxy)-4-oxobutyl]amino]ethoxy]ethoxy]ethylamino]pentanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylpropyl 5-[2-[2-[2-[[4-(2-methylpropoxy)-4-oxobutyl]amino]ethoxy]ethoxy]ethylamino]pentanoate?
The IUPAC name of 2-methylpropyl 5-[2-[2-[2-[[4-(2-methylpropoxy)-4-oxobutyl]amino]ethoxy]ethoxy]ethylamino]pentanoate (CID 134487391) is 2-methylpropyl 5-[2-[2-[2-[[4-(2-methylpropoxy)-4-oxobutyl]amino]ethoxy]ethoxy]ethylamino]pentanoate.
What is the SMILES notation for 2-methylpropyl 5-[2-[2-[2-[[4-(2-methylpropoxy)-4-oxobutyl]amino]ethoxy]ethoxy]ethylamino]pentanoate?
The canonical SMILES for 2-methylpropyl 5-[2-[2-[2-[[4-(2-methylpropoxy)-4-oxobutyl]amino]ethoxy]ethoxy]ethylamino]pentanoate is CC(C)COC(=O)CCCCNCCOCCOCCNCCCC(=O)OCC(C)C.
What is the InChIKey of 2-methylpropyl 5-[2-[2-[2-[[4-(2-methylpropoxy)-4-oxobutyl]amino]ethoxy]ethoxy]ethylamino]pentanoate?
The InChIKey is KFCBOASMRXQMLT-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H46N2O6/c1-20(2)18-30-22(26)8-5-6-10-24-12-14-28-16-17-29-15-13-25-11-7-9-23(27)31-19-21(3)4/h20-21,24-25H,5-19H2,1-4H3.
What are the key properties of 2-methylpropyl 5-[2-[2-[2-[[4-(2-methylpropoxy)-4-oxobutyl]amino]ethoxy]ethoxy]ethylamino]pentanoate?
2-methylpropyl 5-[2-[2-[2-[[4-(2-methylpropoxy)-4-oxobutyl]amino]ethoxy]ethoxy]ethylamino]pentanoate has a molecular weight of 446.63 g/mol, XLogP of 2.55, 22 rotatable bonds, 2 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylpropyl 5-[2-[2-[2-[[4-(2-methylpropoxy)-4-oxobutyl]amino]ethoxy]ethoxy]ethylamino]pentanoate is sourced from PubChem (CID 134487391), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).