C17H30N2 — CID 134488813
N-[3-[6-(2,2-dimethylpropyl)-3-pyridinyl]propyl]-2-methylpropan-2-amine (PubChem CID 134488813) has the molecular formula C17H30N2 and a molecular weight of 262.44 g/mol. Its IUPAC name is N-[3-[6-(2,2-dimethylpropyl)-3-pyridinyl]propyl]-2-methylpropan-2-amine.
| Compound Name | N-[3-[6-(2,2-dimethylpropyl)-3-pyridinyl]propyl]-2-methylpropan-2-amine |
|---|---|
| PubChem CID | 134488813 |
| Molecular Formula | C17H30N2 |
| Molecular Weight | 262.44 g/mol |
| Exact Mass | 262.24 |
| IUPAC Name | N-[3-[6-(2,2-dimethylpropyl)-3-pyridinyl]propyl]-2-methylpropan-2-amine |
| SMILES | CC(C)(C)Cc1ccc(CCCNC(C)(C)C)cn1 |
| InChI | InChI=1S/C17H30N2/c1-16(2,3)12-15-10-9-14(13-18-15)8-7-11-19-17(4,5)6/h9-10,13,19H,7-8,11-12H2,1-6H3 |
| InChIKey | HVVOTKZQJOPDJC-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.44 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|