C22H40N2O3 — CID 134488866
1-(6-tert-butyl-2-azaspiro[3.3]heptan-2-yl)-2-[3-(1-tert-butylazetidin-3-yl)oxypropoxy]ethanone (PubChem CID 134488866) has the molecular formula C22H40N2O3 and a molecular weight of 380.57 g/mol. Its IUPAC name is 1-(6-tert-butyl-2-azaspiro[3.3]heptan-2-yl)-2-[3-(1-tert-butylazetidin-3-yl)oxypropoxy]ethanone.
| Compound Name | 1-(6-tert-butyl-2-azaspiro[3.3]heptan-2-yl)-2-[3-(1-tert-butylazetidin-3-yl)oxypropoxy]ethanone |
|---|---|
| PubChem CID | 134488866 |
| Molecular Formula | C22H40N2O3 |
| Molecular Weight | 380.57 g/mol |
| Exact Mass | 380.30 |
| IUPAC Name | 1-(6-tert-butyl-2-azaspiro[3.3]heptan-2-yl)-2-[3-(1-tert-butylazetidin-3-yl)oxypropoxy]ethanone |
| SMILES | CC(C)(C)C1CC2(C1)CN(C(=O)COCCCOC1CN(C(C)(C)C)C1)C2 |
| InChI | InChI=1S/C22H40N2O3/c1-20(2,3)17-10-22(11-17)15-23(16-22)19(25)14-26-8-7-9-27-18-12-24(13-18)21(4,5)6/h17-18H,7-16H2,1-6H3 |
| InChIKey | MZIFYOCCARLGMY-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.57 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|