C21H39F2NO3 — CID 140899182
1-tert-butyl-3-[3-[3-(3-tert-butylcyclobutyl)oxypropoxy]-2,2-difluoropropoxy]azetidine (PubChem CID 140899182) has the molecular formula C21H39F2NO3 and a molecular weight of 391.54 g/mol. Its IUPAC name is 1-tert-butyl-3-[3-[3-(3-tert-butylcyclobutyl)oxypropoxy]-2,2-difluoropropoxy]azetidine.
| Compound Name | 1-tert-butyl-3-[3-[3-(3-tert-butylcyclobutyl)oxypropoxy]-2,2-difluoropropoxy]azetidine |
|---|---|
| PubChem CID | 140899182 |
| Molecular Formula | C21H39F2NO3 |
| Molecular Weight | 391.54 g/mol |
| Exact Mass | 391.29 |
| IUPAC Name | 1-tert-butyl-3-[3-[3-(3-tert-butylcyclobutyl)oxypropoxy]-2,2-difluoropropoxy]azetidine |
| SMILES | CC(C)(C)C1CC(OCCCOCC(F)(F)COC2CN(C(C)(C)C)C2)C1 |
| InChI | InChI=1S/C21H39F2NO3/c1-19(2,3)16-10-17(11-16)26-9-7-8-25-14-21(22,23)15-27-18-12-24(13-18)20(4,5)6/h16-18H,7-15H2,1-6H3 |
| InChIKey | ADVBYQFYVMKZDG-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.54 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|