C14H29NO — CID 170651654
(3R)-1-tert-butyl-3-(3,3-dimethylbutoxy)pyrrolidine (PubChem CID 170651654) has the molecular formula C14H29NO and a molecular weight of 227.39 g/mol. Its IUPAC name is (3R)-1-tert-butyl-3-(3,3-dimethylbutoxy)pyrrolidine.
| Compound Name | (3R)-1-tert-butyl-3-(3,3-dimethylbutoxy)pyrrolidine |
|---|---|
| PubChem CID | 170651654 |
| Molecular Formula | C14H29NO |
| Molecular Weight | 227.39 g/mol |
| Exact Mass | 227.22 |
| IUPAC Name | (3R)-1-tert-butyl-3-(3,3-dimethylbutoxy)pyrrolidine |
| SMILES | CC(C)(C)CCO[C@@H]1CCN(C(C)(C)C)C1 |
| InChI | InChI=1S/C14H29NO/c1-13(2,3)8-10-16-12-7-9-15(11-12)14(4,5)6/h12H,7-11H2,1-6H3/t12-/m1/s1 |
| InChIKey | CKJYHDNEHKLJGI-GFCCVEGCSA-N |
| XLogP | 3.31 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.39 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |