C14H26ClNO2 — CID 114212917
1-[4-(2-chloroethoxy)piperidin-1-yl]-4,4-dimethylpentan-1-one (PubChem CID 114212917) has the molecular formula C14H26ClNO2 and a molecular weight of 275.82 g/mol. Its IUPAC name is 1-[4-(2-chloroethoxy)piperidin-1-yl]-4,4-dimethylpentan-1-one.
| Compound Name | 1-[4-(2-chloroethoxy)piperidin-1-yl]-4,4-dimethylpentan-1-one |
|---|---|
| PubChem CID | 114212917 |
| Molecular Formula | C14H26ClNO2 |
| Molecular Weight | 275.82 g/mol |
| Exact Mass | 275.17 |
| IUPAC Name | 1-[4-(2-chloroethoxy)piperidin-1-yl]-4,4-dimethylpentan-1-one |
| SMILES | CC(C)(C)CCC(=O)N1CCC(OCCCl)CC1 |
| InChI | InChI=1S/C14H26ClNO2/c1-14(2,3)7-4-13(17)16-9-5-12(6-10-16)18-11-8-15/h12H,4-11H2,1-3H3 |
| InChIKey | NRFGGWFJTNQQLA-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.82 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|