C13H24ClNO2 — CID 82701908
1-[4-(2-chloroethoxy)piperidin-1-yl]-3,3-dimethylbutan-1-one (PubChem CID 82701908) has the molecular formula C13H24ClNO2 and a molecular weight of 261.79 g/mol. Its IUPAC name is 1-[4-(2-chloroethoxy)piperidin-1-yl]-3,3-dimethylbutan-1-one.
| Compound Name | 1-[4-(2-chloroethoxy)piperidin-1-yl]-3,3-dimethylbutan-1-one |
|---|---|
| PubChem CID | 82701908 |
| Molecular Formula | C13H24ClNO2 |
| Molecular Weight | 261.79 g/mol |
| Exact Mass | 261.15 |
| IUPAC Name | 1-[4-(2-chloroethoxy)piperidin-1-yl]-3,3-dimethylbutan-1-one |
| SMILES | CC(C)(C)CC(=O)N1CCC(OCCCl)CC1 |
| InChI | InChI=1S/C13H24ClNO2/c1-13(2,3)10-12(16)15-7-4-11(5-8-15)17-9-6-14/h11H,4-10H2,1-3H3 |
| InChIKey | DEUWTQFSRUDDMJ-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.79 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|