C15H28ClNO2 — CID 82701754
1-[4-(2-chloroethoxy)piperidin-1-yl]-3,4,4-trimethylpentan-1-one (PubChem CID 82701754) has the molecular formula C15H28ClNO2 and a molecular weight of 289.85 g/mol. Its IUPAC name is 1-[4-(2-chloroethoxy)piperidin-1-yl]-3,4,4-trimethylpentan-1-one.
| Compound Name | 1-[4-(2-chloroethoxy)piperidin-1-yl]-3,4,4-trimethylpentan-1-one |
|---|---|
| PubChem CID | 82701754 |
| Molecular Formula | C15H28ClNO2 |
| Molecular Weight | 289.85 g/mol |
| Exact Mass | 289.18 |
| IUPAC Name | 1-[4-(2-chloroethoxy)piperidin-1-yl]-3,4,4-trimethylpentan-1-one |
| SMILES | CC(CC(=O)N1CCC(OCCCl)CC1)C(C)(C)C |
| InChI | InChI=1S/C15H28ClNO2/c1-12(15(2,3)4)11-14(18)17-8-5-13(6-9-17)19-10-7-16/h12-13H,5-11H2,1-4H3 |
| InChIKey | CZUYIKFPZGYZCW-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.85 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|