C23H41NO3 — CID 134488993
4-[3-[(2-methylpropan-2-yl)oxy]cyclobutyl]oxy-1-[6-[(2-methylpropan-2-yl)oxy]hex-4-ynyl]piperidine (PubChem CID 134488993) has the molecular formula C23H41NO3 and a molecular weight of 379.59 g/mol. Its IUPAC name is 4-[3-[(2-methylpropan-2-yl)oxy]cyclobutyl]oxy-1-[6-[(2-methylpropan-2-yl)oxy]hex-4-ynyl]piperidine.
| Compound Name | 4-[3-[(2-methylpropan-2-yl)oxy]cyclobutyl]oxy-1-[6-[(2-methylpropan-2-yl)oxy]hex-4-ynyl]piperidine |
|---|---|
| PubChem CID | 134488993 |
| Molecular Formula | C23H41NO3 |
| Molecular Weight | 379.59 g/mol |
| Exact Mass | 379.31 |
| IUPAC Name | 4-[3-[(2-methylpropan-2-yl)oxy]cyclobutyl]oxy-1-[6-[(2-methylpropan-2-yl)oxy]hex-4-ynyl]piperidine |
| SMILES | CC(C)(C)OCC#CCCCN1CCC(OC2CC(OC(C)(C)C)C2)CC1 |
| InChI | InChI=1S/C23H41NO3/c1-22(2,3)25-16-10-8-7-9-13-24-14-11-19(12-15-24)26-20-17-21(18-20)27-23(4,5)6/h19-21H,7,9,11-18H2,1-6H3 |
| InChIKey | QMYRHUSCTVZCRH-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.59 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|